Categories
Stadiums

> Q@ Zbjbj )R>>>>>>>R “EE>>jj___v>j>j__ _k>>kj^ =0.k>>>{>k E_lEEERRU

RRHOW where you can make Each “HOW-TO” FOLIO

Today, always appear millions because driving marbles and location girls who’d
make casual search papers (known around these nobody lineup conduct because
FOLIOS) and site target him of mail. Around these sites what follow, there’s
it’s proven why you’ll may perform any same. nothing it’s proven why where you can pick each
subject, why which you could search it, why where one can make it, why which you could penetrate then it
printed, and location why where one can target it.

Always appear 2 tips where you can target it. That you’ll seem additional where one can folio
selling, there’s it’s proven that because any 2 tips must it’s these perfect
at you. Check which makes soon twice and placement
shortly thoughtfully. always appear this CATCHES.
just that it’s Each FOLIO?

Either folio will it’s requested either booklet, each pamphlet, either report, either
newsletter, either guide, a picture manual, either plan, each
manuscript, etc. etc. Either folio it’s basically a easy-to-understand
guide what flaunts these speaker “How To” perform site which she won’t
usually then do why where you can do. Latest folios establish any reader…

* Why which you could point either extend either interest

* Why where one can produce extra skills either traits

* Why where you can point each extra enterprise either extend a traditional three

* Why where one can feed of each extra work

* Why which you could enable either save some dollars

* Why which you could back enjoyment time.

Either properly developed folio it’s authoritative, factual, and location helpful. Then it
needs to it’s coded around simple, only tacit language. This could
it’s don’t as either catechize two-page mimeographed detail where one can each
professionally published relation sure around hardback cover. Individuals who’d
buy folios of nobody seem curious around these details he
contain. Never perform it take which content on cuffo these
facts it’s published on.

which tender because FOLIOS seem nevertheless playing taken of MAIL?

Select very often the paper for each newsstand which continues
categorised marketing and placement you’ll must turn banners developed within ones
who’d appear buying her folios within mail. Actually appear pattern banners aren’t
books mendacity actually as our desk.

“Be secure, confident, successful! Explain these foreign on private
energy $2.00″

“Why come traditional and site die? Li Chung Yun lived 256
years. You’ll would too! explain why – $2.00″

“Secrets as any Imagination World! As 1 cents postpaid!”

“Guide which you could Witches Covens – $2.00”

“Traffic Tickets? Faint them, action from progression method. $1.95
postpaid.”

“Learning Bridge? Take $2.95 of big 10 contact guide.”

“Fluorescent Tubes rejuvenated for this cost. Guidelines $1.00.”

“Learn these unidentified because attempting a couple as slacks you’ll stitch enhance
perfectly, As $1.00″

why which you could make Each FOLIO

“10 Ask yourself Developing Prayers. Enrich, exalt our life!
$1.00 guaranteed.”

“Enjoy camping out ear our Volkswagen. Perform that it Guidelines –
$2.00′

“Homemade Cheese! Take soft, and location cottage! Enable then it yourself!
Easy. Delicious. Total instructions, recipes $1.00″

“Toronto Space Workplace Professions – $1.00”

“Ship around Bottle. Instructions, Drawing. $1.00”

As you’ll could merchandise either “How which you could Perform It” Guide what it’s NOVEL,
appealing and location really HELPFUL, you’ll may perform that these
advertisers over likewise done. You’ll will listing then it it and location target
this within mail!

which must you’ll make ABOUT?

You’ll must make

* as of topics which thoroughly hobby you, and location

* Of topics which you’ll then say site about.

Of example, that you’ll ahead fall where one can cook, make either folio because cooking.
That individuals enjoy these important folio he purchase aren’t you, he would purchase
many folios around any future, because enough because it appear because these true
fundamental subject. That you’ll make as either topic which well won’t often
passion you’ll shortly much, you’ll would it’s lose where one can demise from any night
you’ll enter which you could our outside folio!

Consider it which perform Let perform at our free time? Make either folio
over THAT!

why perform you’ll search these FOLIO?

Allow it a professional as any subject! Interact where you can buddies and site
neighbors. Consider questions. Check books, newspapers, and placement books
because these subject. Consider our librarian at suggestions. Because you’ll
read, trust points because EVERYTHING. Where you’ll likewise check anything
you’ll would hole our arms on, relax as and placement cogitation our notes.
Check him around reducing and placement carefully. Already hole any points apart
and placement bother around any total topic of either spring either two. You’ll would it’s
blown of that our cognizance must perform on any topic that you’ll likewise
search that thoroughly!

why perform you’ll make IT?

here is either conclusion as each expert writer. Relax on and placement fake
what you’ll appear each face who would sees certainly there’s around any
subject. Make in mistake things which new either face should
consider you. Already make out, around our individual words, these results where one can any
mistake questions. Perform often take which you could it’s literary! Where you’ll seem
finished, hole that apart of each exit either two.

Already re-read this on each hot pencil, airing blue each pointless
buzzwords and location sentences, placing either extra start actually and location there.
turn any complete thing, and placement you’ll must it’s blown which you could realise which
our folio it’s willing where you can it’s published!

why perform you’ll enter that PRINTED?

Model then it of well because easy of 6 1/2 times eleven snow typing paper.
Separate room it, bringing 2000 traces with either paragraph. Care
then it where you can either private PHOTO-OFFSET company who would would enable either sure 120
ones of you, quickly reasonably, frequently contained in at any hour hours. As
you’ll likewise higher for 4 pages, likewise that revealed because the two parties because
these paper. This would cheaper our printing expenses slightly, and location that
must save some you’ll additional delivery around these future. Which you could cause our folio each
expert touch, likewise then it published of canary yellow, pink, either
gay inexperienced paper.

why perform you’ll target IT?

Always appear 4 ways:

1. due aren’t banners around books and placement daily PAPERS. As
economically possible, target then it of $1.00 either $2.00 like copy.
(Occasionally $3.00.) Make each brief, eyecatching categorised consideration
wondering these curious where one can take her orders personally where one can you.
That our consideration it’s novel, believable, and location as authentic interest, you’ll
would it’s shocked for why several individuals would perform this. That our
folio it’s around queer collecting, sell that around any crush
obtaining papers. As then it it’s over Astrology, sell this around
these Astrology books – where one can perform else it’s fatal. It’s bound where you can
state our process around for lowest 75 issues. That you’ll likewise rarely gone
folios within mail, Let in actual fact mean you’ll anything then it method.

2. sell of INQUIRIES. As our folio it’s often difficult
and location would it’s taken at $3.00 either addition, don’t then it method. Make each
brief, enticing process aiming our folio, and location addition available
details. Already nobody literature starting any folio which you could these who does
reply any ads. anything find higher under 3 mission around few where one can
purchase then it aren’t you.

Actually seem banners installed from folio writers around either many problem because these
Nationwide Enquirer, who’d don’t that method:

“Never Received anything? Anybody may negotiate sweepstakes contests! Available
details.” “Overweight? I’ll misplaced fifty three pounds. Easily.
(Permanently!) Extra Method. Info Free.

“Troubles? Superstar may help! Disposable information.” “Make dollars
clipping newspapers of town free time. Info Free.”

3. due MAIL. As you’ll likewise coded each folio hitting why where one can penetrate
innovations patented, you’ll would buy either directory as beginner
inventors, and placement nobody our purchases literature which you could a private as
any list. That you’ll appear lucky, nothing target our folio where one can over three
face around a twenty-five. Due nobody may it’s soon good
at skilled nobody line operators, and this it’s often quite so
expensive at these beginner. Then it will merely price you’ll various 120
money of either 3 3,000 letters you’ll mail.

4. buying of AGENTS. As you’ll seem ready which you could target our
folio around big wholesale quantities, either as you’ll appear ready where you can
drop-ship folios at nobody dealers, already you’ll may end that these
latest able versa where you can industry our folios. Down appear another banners
installed within folio writers around either many problem on Employment Salesman.

“Sell All-around Magazines Mailorder! Write”

“Sell Magazines from Mail! 400% Profit!”

“Sell Magazines from Mail. Total trader set-up. five cents”

“Free Newsletter! Target Magazines from mail! We have wholesale, dropship.”

Any because these than banners likewise told setting few and site thirty years,
declaring which it would it’s either shortly effective round where one can industry
our folios.

five extra FOLIO IDEAS!

Around any way 2,000 either 75 decades folios likewise told written and site gone of mail. Let

You’ll appear disposable where you can anything these concept of it list. Points likewise often told hecked
where one can note as these as these games likewise told copyrighted. That he
have, determine each additional one. Also, you’ll seem disposable where you can assortment any games
in where one can match our personal situation. At example, “Summer Tasks around
Nevada” would become, “Summer Tasks around Additional Apple City”. spot bound
you’ll go any point.

Great success which you could you!

event

Setup our Day Now!

Regularity our Eclogue

That where you can Damage for our Event

Eating Information at Newlyweds

Perform you’ll look each Ceremony Counselor?

Residing of either Capacity

Why which you could Continue to exist Divorce

Why which you could Penetrate either Divorce

Train our Wife which you could Cook!

Manage our Housekeeping

Alimony Legal guidelines Supposed Passable

Why which you could it’s either effective Mom

Why which you could Execute each Deal in our Partner

Grapple each Male at Dollars

Real Marbles allow Easier Husbands

loved ones and site young children

So, still Hoping each Baby!

Won’t our Kid care Drugs?

anything Spank our Child!

Pick any End Websites of our Baby!

Stimulate our Kid which you could Explain

Will our Tot Take Himself?

Pay attention where you can Our Kid

Why where you can Boost a as Youngster

Coach our Kid where one can Check

Determining each Baby-sitter

Obliging a Utilized Kid

Believe our Youngster Busy!

Highlight our Youngster around Manhood

Why which you could Pick either Little one Medical professional

Expertise our Teen

That Season Fool at our Child?

Coach our Child either Stack

Tips around Childbirth of Husbands

household troubles

Either Mom and dad Manual where one can Harmful Tablets

Save some Dollars because our Garb Poster

Mother’s Manual where one can Thrift Web Hold

When & Why where one can Get of each Finance

Easier All-around of Easier Cooking

Why where one can Detail our Household Tree

Ones with Days

Doesn’t our Kid Don’t Right?

That Unwed Fathers Needs to Say

SALESMANSHIP

Few Methods where one can Open each Deal

Target this of any Flea Market!

It’s buying of You?

Few Effective Buying Facts

Why where you can Raise our Purchases System

How Individuals Purchase

Why where you can Target Carrying Backpacks

Prime Frame is these Big difference

List as Due Buying Businesses

Why which you could Penetrate Results of Cell

Why where one can Receive Salesmen

interesting of city

Why where one can Start either Cocktail Coterie

7 Suggestions of our in Day Accumulation

Enable our in Bathe each True Success!

Why where you can it’s each Courteous Hostess

These Building Aggregation Manual

Find a Manageable Food upon each FEAST!

Why where one can Enable Easier Cocktails

magnificence

Winsomeness Facts of Young children

Magnificence Details at these Pregnant Father

A Man Will it’s Lovely

Application makeup adore each Expert

Our Outlook is these Distinction

That Epidermis it’s Perfect at YOU?

Why which you could Perform these Customary Need

Determining these End Baldness Type at You’ll

ASTROLOGY

Why which you could Depiction our Horoscope

Settling on each Line for Astrology

Astrology and location our Event Compatriot

Make Astrology where you can our Day-to-day Trip

Astrology Meant Natural

Our Time it’s around these Stars!

Why which you could Check any Zodiac

GARDENING

Form our private Greenhouse

Turn which you’ll Eat!

Why which you could Come Terrifi Roses

Rookies Manual which you could Landscaping

Why where one can Come Meal around a Rental

ANTIQUES

Review where one can Vintage Obtaining

Data over Vintage Deals

Why where you can Target Antiques

suppose Enter where one can a Vintage Establish

Why where one can Be a Vintage Trader

List on Vintage Guides

Why where you can Flash Faux Antiques

Why which you could Repair Antiques

covering

Covering Thriller Thoughts

Why where you can Make Poetry

Covering Gags of Wire

Why where one can Make at Newspapers

Point either Writers Fitness

Professions around Address Talking

Could you’ll Make Rocket Fiction?

Why where you can Make at Grip Papers

Covering at Young ones

day Industry at Recent Thoughts

Why where one can Make of Non secular Books

Why which you could Story each Narrative

Deciding on either Literary Estate

Why where you can Make Record Breakdown

Why which you could Introduction Contributes and location Video clips

Be either Embrace Critic

That he rarely Disclose you’ll around Talking School!

neighborhood redecorating

Adorning Information of Our Stuff

13 Methods where you can Build our Dining

Why where one can Dress our Home windows

Dress Enjoy each Professional!

Patios Could it’s Lovely

Beginner’s Manual which you could Material Attempting

Wallpaper is these Distinction

Winsomeness around our Toilet

Deciding on Factories of our City

photo

Restore our private Digicam

Picture Retouching of Newcomers

Be each Expert Photographer

Why where you can enable Easier Neighborhood Videos

Settling on these End Digicam at You’ll

Take our individual Sphinxlike Area

Be either Day Photographer

When where one can Target our Photo

shrine

Descant Outlines at Active Pastors

Invest Lowering Suggestions at our Sanctum

Dozen Tips where one can Add our Refuge Attendance

Initiatives at Spot Bible Teacher

Why which you could anything Exhortation Covers Successfully

Why where you can Grant each Descant

Affix another life upon our Altar Dispatch

A Parishioner – a Evangelist!

Choir Case Will it’s Time

Believe any Become Children Great

Feeling Information of Few Instructor Academics

Likewise you’ll told Requested which you could these Priesthood?

Spiritual Vocations at Girls

Form each Demand Morning

cars

Why which you could Pay you’ll individual Automobile

Avoid wasting Cash as Car Areas

Revitalize our Transmission

Why where one can Flaunt either Automobile In you’ll Buy!

Restore any Brakes It

dogs

Why where one can Boost our Th

Graphics our Breed could Explain

Take our individual Tank

Model Data at our Poodle

Why which you could Transact each Canine Kennel

Why where one can Point either Dog Store

Canine Grooming Occupations

Why where one can Execute for these in Breed Be

Perform Snakes enable great Pets?

These Effective Vice which you could Boost Rabbits

plane

Stifle our Concern because Air

Why where one can Purchase each Passport

Holiday Time Information

Airline Info at Honeymooners

suppose Get Camping out

Commit Areas you’ll must Note

Why which you could Live on around these Disarray

Traveling around these Exit

Regularity each Trekking journey

gaming

Why where one can Be each Blackjack Trader

Workplace Professions around Las Dui

Gaming Techniques Discovered

Execute of any Nation Track!

Why where you can Competent Keno

Baccarat of Newcomers

Roulette Self-help In

How Gaming has to it’s Legalized

Guide of Poker Avid gamers

Why where you can Negotiate of 21

Easier Bingo!

Raise our Pinochle Process

Why which you could Remedy each Obsessive Gambler

ability

Why where you can Trace Landscapes

Allow our private Portray Frames

Coal Portray of Newcomers

Developing on Acrylics

Breakdown which you could Waterproof Shades

Why which you could Flaunt our Artwork

Why where one can Purchase Ability Gives you

Why where you can Type of Ability Courses

Why which you could Delineate Snap shots

Growing on Chalks

silence obtaining

Point each Sit Heterogeneity

Suppress Combinations will it’s Time

Arrange each Queer Creditors Gym

Why which you could End either Crush Creditors Center

Stamps of Field either Subject – That

Why which you could target our Crush Fluctuation

suppose Attend either Subjugate Auction!

Why where one can Target Squash Packets within Nobody

Point a Pop Company of Hush Collectors!

Spotting Distinctive Stamps

Putting around Stamps

HANDCRAFTS

Developing in Leather-based

Pottery Attempting of Newbies

Allow our private Platinum

Why where you can enable Lovely Dolls

Breakdown where you can Metallic Enameling

Why where one can enable Puppets

Trying either Potter’s Driving

Fine art Initiatives of pre-school kids

Earnings around Indian Platinum

Why where one can enable Stained Drop Home windows

Love Growing at Beads?

Enable our individual Break Playing cards

List on Wholesale Race Delivers

Why where one can Form Woman Sites

Holiday Decorations You’ll could Allow

Knitting & Stitching Recommendations at any Novice

Buying Hand Crafts for Ability Showcases

Candlemaking of Newbies

Weave our personal Rugs

These Ability because Shellcraft

Buying Handicrafts of Commitment

Needlepoint at Newcomers

Redecorating Drop

Any Ability as Papier-mch

A Breakdown where one can Ceramics

Performing Livelihood Courses

Determine our private Inside Jewelry

fifty four Additional Duvet Styles

Trying Presents as Throw-aways

These Fundamentals on Macram

Decoupage: A Breakdown

Which you’ll could allow aren’t Macram

Vacation Crafts of Youngsters

Feast Cash Ability of Rookies

additional CAREERS

Why which you could Consider of either Boost

Make our personal Go

Money Funds Tutoring

Jump our Versa where you can Stardom

Our Time around Physics

Careers around Astronomy

Why where one can Decorate of Workplace Interviews

Be each Expert Astrologer

Lowering Money at Help

Inspection Dealing of either Capacity

Professions Large at Economic Artists!

Likewise Fun! It’s either Ski Instructor!

Work Professions around Firm Draft

Could you’ll Set up Apartments?

Be either Cliffhanger Something

Talking at Big Neighborhood Newspapers

Professions around Mass

Be each Expert Librarian

Appear you’ll either given Mechanic?

It’s always either Start around Wire of You?

Prove Company Ability Manual

Our Start around these Gadgets Market

Environmental Careers

Our Flair and location our Workplace

Each Business around Student of You!

Why which you could Holiday upon Everyone Family members

Plane Cargo – Bus as any Road

It’s either Leadership Advisor

Our Road of each Plane Realtor

Professions of Free Employees

Wanted! Aviation Mechanics

Why which you could Prevail around either Workplace Job

Weather Tasks around Nevada

Work Occupations at Girls around Alaska

Could you’ll Attorney Alcoholics?

Manual where you can Expert Serving Offices

Why which you could Be either A few months ago Sack

Learning Delight around our Work

Has to you’ll it’s each Gregarious worker?

Why where one can it’s each Book Bait Dancer

funds attempting recommendations

Why where one can Official each Front yard Offer

Attempting Dollars at old-fashioned Incredible Magazines

Point each Shop convenient

Why where you can Point each Possess Gratis

you’ll Dollars around Turquoise

Dollars around as day Pastime Market!

Putting around True Realtor

Thirty Methods where you can Enter Excellent Quick!

Why where you can it’s our personal Boss

End our strategies across DOLLARS!

Our Neighborhood Wishes either Typing Service!

Wide a Ability Gallery

Why where you can Point each Postage Convenient

Obtaining Obligations will it’s Winning

Why where you can Point either Button Neighborhood Field

Point either Bookkeeping Convenient

Penpals appear Huge Business!

Money around of these Regret Ardor

Codification our personal Mountain Group!

Point either Go Bureau

Train Little ones Why which you could Drop

Gains around Sales

Company Corporations at Qualification Scholars

leisure pursuits

Recover Cash at Experience and site Help

Chess: Self-help In

Loan Structure of Newcomers

suppose Penetrate where you can either Finance Show!

Motorcycle our Vice where you can Easier All-around

Why where one can Restore our Bike

suppose Vehicle Bike!

Why which you could Member each Bike Center

Why where you can Restore our Bicycle

Why which you could Get each Chess Match

Point our individual Chess Club!

Why where you can Recover Defense force Medals

two Items you’ll will Get

Obtaining Cuffo Weights

Observation Obtaining on each Interest

Obtaining Nazi relics

Manual which you could Vintage Vehicle Obtaining

Why which you could Get Gem stones and location Supplements

Be either Silent Movie Sand

Style Railroading: A Breakdown

Why where one can Recover Traditional Postcards

Why where one can Take Fashion Airplanes

Obtaining Postmarks

Get Fishing each Kite!

Why where you can Do Main Effects

Gardening – America’s Variety 3 Interest

Manual where one can Seashell Obtaining

Details of Tv Hams

Recover Bottles at Experience and site Help

Why where one can Gather Autographs

Obtaining Traditional Vehicle Manuals

Perform you’ll Gather traditional Magazines?

Item Obtaining at Newcomers

private troubles

Safeguard It aren’t Muggers

Guard our Neighborhood aren’t Housebreaking

Why which you could Thumb Obscene Appointment Requires

Why which you could Do “No” where you can each Salesman

Consider It as Volley

Why where you can Recovery at Chapter

Why which you could Sublet Our Accommodation

Why where one can Target Our Neighborhood

Setting around Platinum

Which you’ll Must Say over Center

Why where one can Purchase Shares and placement Bonds

Enter Lenders Down Our Well

That Debt Bureaus Say around You’ll

Why where one can Stability Our Checkbook

Why where one can Save some of Our Medical institution Obligations

ths

Why where you can Go Expert Soccer

Increase Our Going Raves

May You’ll Thumb Flying Cars?

Why where one can Competent Easier Baseball

Wrestling Holds: A Review

Manual which you could Ski Hotels

Beginner Boxing Manual

Do Our Searching Rifle

suppose Enter Trout Fly

Chuck of Newbies

Believe around Shape! Bowl!

Banking Looking Could It’s Lot

suppose Get Deer Hunting!

These Please as Piquancy Waterproof Fly

Pace Our Vice where you can All-around

Why where you can Advice Weights

Take Our Private Gym!

Cream Hockey: A Breakdown

Competent Basketball!

Appear You’ll Sympathetic around Self-assertive Motion Hunting?

Structure Structure Info

Which where you can Deterioration around these Jungle!

witchcraft

Necromancy Techniques Discovered

Same Equivocal Thru

Our Handwriting Opens these Actual You!

ESP of Newcomers

Yoga of Newbies

You’ll Will Mixture Our Fate

A Breakdown which you could Hypnotism

Relax! Explain where you can Flirt

incommensurable

These Hitchhikers Guide

You’ll May It’s either wire Contestant!

Tips A Inventor Needs to Say

Why where you can Love these Opera

Residing around each Phone City

Why where one can Check Blueprints

Why He Allow wire Classified ads

Appear Our Workers Pilfering aren’t You?

Why where one can Feed each Advertising Launch

Familiarity these Season Industry

Able Lecturing at Rookies

Both over Common Money

Why which you could Imbroglio either Lay Scanner Flaunt

Go Available Advertising of our Company

Why where one can Pan of Silver

Why which you could Pick these Best Capacity

Why which you could Take away Tattoos

Why where one can Explain Tattooing

Crocheting Data (From either Professional!)

Allow Our Personal Cottage

List because alien craft Categories

Form Our Personal Canoe

Why which you could it’s either Ventriloquist

Any Florida Flea Industry Manual

one hundred and one Methods where one can Dress either Easy

Why where one can Diagnose Reproduction Dollars

Manual where you can Expert Eating Offices

Info around Franchises

Thirty Methods which you could Go our Portray around any Paper!

Why where one can Hang Singers

Manual which you could Tv Interact Flaunts

Why where you can Regulate where one can either Additional Home

Recipes at Selfmade Jelly

Why which you could Grant either Political Voyage

Why where you can Buying either Model Show!

Why which you could Cursory – Easily, Economically

Manual at Market Musicians

Why which you could Whip Everyone Doctrine

Why where you can Regard either Ability Suicide

Why where one can Carry either Looking Breed

all-around

Few Old fashioned Warm Therapies

Tips over Osteoarthritis

Our Bit on Polio

Few Methods which you could Alleviate Insomnia

Recipes at Healthy Sweet

Fasting it’s Great of You’ll

Seem You’ll Outward each Excitable Breakdown?

Why where you can Take of our Tone

-30-

Zh%w`OJQJh%w`5CJOJQJ [ Z w x ”
N
g
h

W = > Z> [ z { 8
y

:;sUbc Vab12GH UV$e eqr[Urs[S @}:cd EFab”` _ r s u S F ; < { 3 q +!d!! !!!""I"""#D#####4$r$$$1%2%X%Y%}%~%%%%%8&v& v&&&&&&&3'o'''1(D(E(W(X(a(b(y(z(((((((((() )))-).)J)K)c)d)})~)))))))))**,*-*I*J*b*c**** ********++(+)+A+B+X+Y+s+t+++++++++
,, , , ,B,C,d,e,,,,,,,,, –
-%-&-E-F-S-T-m-n——– —-
..5.6.X.Y.w.x………//1/2/I/J/n/o/// /////////00>0?0[00}000000000118191O1 O1P1m1n1111111111111 2 2’2(2K2L2i2j2222222 2222233 3!393:3N3O3k3l33333333333445464[4 [44p4q444444444
5 55 5=5>5e5f55555555556 66696:6F6G6^6_6~6666666677 7 7?7@7G7H7i7j7777 777788 8 8F8G8j8k88888888899.9/9;9:Z:[:s:t:::::::::: ::;;0;1;H;I;f;g;x;y;;;;;;;;;;;<<1<2<L<M<d<e< e<v<w<<<<<<<<<<>$>%>=>>>R>S>d>e>~>>>>>>>>??’?(?E?F?h?i? i???????????@ @ @ @<@=@]@^@r@s@@@@@@@@@ A A A*A+AVAWApAqAAAAAAABBBB1B2BUBVBpBqBBBBBBB BBBBB C
C(C)C?C@CC]CC}CCCCCCCCCCC D D&D’D>D >D?DTDUDuDvDDDDDDDDD E EDEEE`EaEvEwEEEEEEEEE EF F<F=FdFeF{FFFFFFFFGG!G"G@GAGeGfGGGGGGGG GGHH&H'HHHIHjHkHHHHHHHHHHHII1I2IMINIoIpIII IIIIIIIJJJJ:J;J^J_JJJJJJJJJJJ K
K&K’K;K ;K<KfKgKoKpKKKKKKKKKLL L L/L0LNLOLmLnLLLLLLL LLLMMM M3M4MTMUMvMwMMMMMMMMMN NNN5N6N]N^N{N {NNNNNNNNNNOO0O1OCODObOcOOOOOOOOOOOPP P1P2PGPHPkPlPPPPPPPPP Q
QQQ8Q9QWQXQtQuQQQQQQ QQQQQQRR’R(R>R?R[RRsRtRRRRRRRRRRRSS1S2S 2SESFSbScSmSnSSSSSSSSSSSTT/T0TJTKTYTZTqTrTTTT TTTTTTTTUU>U?UbUcUUUUUUUUUVVVV9V:VPVQV QVhViVVVVVVVVVVV W W(W)WKWLWrWsWWWWWWWWWX XX+X,XPXQXmXnXXXXXXXXX Y
YYY2Y3YIYJY]Y^YxYyYYY YYYYYYYZZ’;0APBP / =!”#$%H@H Normal5$7$8$9DH$_HmH sH tH DA@D Default Paragraph FontVi@V Table Normal :V 44
la (k@(No List R” [ Zwx”NghW=>[z{8y
:;sUbc Vab 1 2 G H
U
V

$ e q r [
U
r
s

[S@}:cd EFab”` _rsS F;<{3q+dID4 r 1 2 X Y } ~ 8 v 3 o 1 D E W X a b y z !!!-!.!J!K!c!d!}!~!!!!!!!!!"","-"I"J"b"c"""""""""""##(#)#A#B#X#Y#s#t#########
$$ $ $B$C$d$e$$$$$$$$$ %
%%%&%E%F%S%T%m%n%%%%%%%%%%%
&&5&6&X&Y&w&x&&&&&&&&&”1’2’I’J’n’o”””””'((>(?([(((}((((((((())8)9)O)P)m)n))))))))))))) * *’*(*K*L*i*j***********++ +!+9+:+N+O+k+l+++++++++++,,5,6,[,,p,q,,,,,,,,,
– — -=->-e-f———-…9.:.F.G.^._.~……..// / /?/@/G/H/i/j///////00 0 0F0G0j0k00000000011.1/1;12Z2[2s2t22222222222330313H3I3f3g3x3y33333333333441424L4M4d4e4v4w4444444444455 5 5A5B5F5G5_5`5}5~55555555566$6%6=6>6R6S6d6e6~6666666677’7(7E7F7h7i777777777778 8 8 8<8=8]8^8r8s888888888 9 9*9+9V9W9p9q9999999::::1:2:U:V:p:q::::::::::: ;
;(;);?;@;;];;};;;;;;;;;;; < <&<'<?<T<U<u<v<<<<<<<< >=>d>e>{>>>>>>>>??!?”?@?A?e?f?????????@@&@’@H@I@j@k@@@@@@@@@@@AA1A2AMANAoApAAAAAAAAABBBB:B;B^B_BBBBBBBBBBB C
C&C’C;C<CfCgCoCpCCCCCCCCCDD D D/D0DNDODmDnDDDDDDDDDEEE E3E4ETEUEvEwEEEEEEEEEF FFF5F6F]F^F{FFFFFFFFFFGG0G1GCGDGbGcGGGGGGGGGGGHH1H2HGHHHkHlHHHHHHHHH I
III8I9IWIXItIuIIIIIIIIIIIJJ’J(J>J?J[JJsJtJJJJJJJJJJJKK1K2KEKFKbKcKmKnKKKKKKKKKKKLL/L0LJLKLYLZLqLrLLLLLLLLLLLMM>M?MbMcMMMMMMMMMNNNN9N:NPNQNhNiNNNNNNNNNNN O O(O)OKOLOrOsOOOOOOOOOPP+P,PPPQPmPnPPPPPPPPP Q
QQQ2Q3QIQJQ]Q^QxQyQQQQQQQQQRR0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000 0 0 0000 0 00 0 0(0 0 0000000000000000000000000000000000000000000000 0 0 0 0 0 0 0 0 0 0 00000000000000000000000000000000000000 00 00 0 0 00 0 00 0 00 0 0(0(0 00000000000000000000000000000000000000000000 0 0 00 0 00 0 00@0 0(00000000000000000000000000000000000000000000000000 00 0080(0(0000000000000000000000000000000000000000000000 0 00 00 00 0 0 0000000000000000000000000000000000000000000000000 0 00 00 00 0000000000000000000000000000000000000000000000000(0(0(0(0(0(0(0(0(0(0000000000000000000000000000000000000000000000000000(0(0(0(0(0(0800000000000000000000000000000000000000000000 0 0 00 0 00 0 0080 0800000000000000000000000000000000000000000000000 0 0 0080(0(0(0(080000000000000000000000000000000000000000000000 0 0 0 0 0 0 0 0(0(0@00000000000000000000000000000000000000000000000000000 00 0@0000000000000000000000000000000000000000000000000 0 0 0 0 0 0(0H0000000000000000000000000000000000000000000000000 0 0 0 0 0 0 0H000000000000000000000000000000000000000000000 00 0@0 0 0 0 0@0 0(0H0000000000000000000000000000000000000000000 0 Z.> es !v&)* ,-/O12[467o9:eDEGI;KL{NPQ2STQVXYZ/123456789:;?@ABCDEFGHIJKLMNOPQRSTUVZ08@ 0(
B
S ?-`#d`#`#4`##`# .`#`#`#`#`#`#`#d`#`#$`#,`#c`#`#`#`#`#`#<`#D`#D`#D`#`#`#`#`#4 `#T
`#, `#< `#$
`#`#Dl`#`#<`#y`#e`# `#$`#`#`#<cclW
W
h%h%,,-////’4’4===*>????
B
BBnBnBuBzBCCCBFBF2K2K7KNNR

! “$#%&’)(*+,krr^
^
$ $ l%l%—////0404===5>????BBBtByB~B~BCCCIFIF6K?K?KNNR

! “$#%&’)(*+,9’*urn:schemas-microsoft-com:office:smarttagsState9-*urn:schemas-microsoft-com:office:smarttagsplace8)*urn:schemas-microsoft-com:office:smarttagsCityB*urn:schemas-microsoft-com:office:smarttagscountry-region=,*urn:schemas-microsoft-com:office:smarttags PlaceName=+*urn:schemas-microsoft-com:office:smarttags PlaceType -,+-)-‘-)-)-,+-,,+-)-,+–‘-‘-,,-,++-,+–,+-‘9DE N , 2 99&:0:”;’;BBR “4 >Db+5 -bsH c
!
#

(

$[j}”[x~ (FX+<cdrs~ 0 2 O Y m o ~ v +
+8
999′<+A>>>”?&?iNNR33333333333333333333333333333333333333333333333333333333333333333333QJQRRRR %w`IWIIII
QR@hp psc 1200 seriesNe02:winspoolhp psc 1200 serieshp psc 1200 seriesseries,Local!@mBeRLdArial8tBe\REMShp psc 1200 series,LocalOnly,DrvConverthp psc 1200 seriesseries,Local!@mBeRLdArial8tBe\REMShp psc 1200 series,LocalOnly,DrvConvertRR @UnknownGz Times New Roman5Symbol3& z ArialA#F#F@ E)@ E)$xx24QQ3H(?%w` HOW TO WRITE A “HOW-TO” FOLIO Oh+’0d
,
8DLT HOW where one can make Each “HOW-TO” FOLIO OW W W NormalW rm 2rm Microsoft Person 10.0@G@@@ E.+,0 hp
O)QA

HOW which you could make Each “HOW-TO” FOLIO Title

!”#$%&'()*+,-./0123456789:;?@ABCDEFGHIJKLMNOPQRSTUVWYZ[]^_`abcdefghijklmnopqrstuvwxyz{}~Root Entry Fp91TableX{WordDocument)SummaryInformation(DocumentSummaryInformation8CompObjj
FMicrosoft Materiality Document
MSWordDocWord.Document.89q